C18H17NO4 — CID 67380938
2-ethyl-4-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]benzoic acid (PubChem CID 67380938) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-ethyl-4-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]benzoic acid.
| Compound Name | 2-ethyl-4-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 67380938 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-ethyl-4-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]benzoic acid |
| SMILES | CCc1cc(N2C(=O)OC[C@H]2c2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C18H17NO4/c1-2-12-10-14(8-9-15(12)17(20)21)19-16(11-23-18(19)22)13-6-4-3-5-7-13/h3-10,16H,2,11H2,1H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | SMNUTVCHYWVFQN-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |