C17H14N4O2 — CID 11616487
(4R)-4-phenyl-3-(1-phenyltriazol-4-yl)-1,3-oxazolidin-2-one (PubChem CID 11616487) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is (4R)-4-phenyl-3-(1-phenyltriazol-4-yl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-(1-phenyltriazol-4-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11616487 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (4R)-4-phenyl-3-(1-phenyltriazol-4-yl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C17H14N4O2/c22-17-21(15(12-23-17)13-7-3-1-4-8-13)16-11-20(19-18-16)14-9-5-2-6-10-14/h1-11,15H,12H2/t15-/m0/s1 |
| InChIKey | PGXKPHXNNPJCEI-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |