C20H24N4O2 — CID 89490052
(4S)-3-[2-(cycloheptylamino)pyrimidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 89490052) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (4S)-3-[2-(cycloheptylamino)pyrimidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[2-(cycloheptylamino)pyrimidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89490052 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (4S)-3-[2-(cycloheptylamino)pyrimidin-4-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N1c1ccnc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C20H24N4O2/c25-20-24(17(14-26-20)15-8-4-3-5-9-15)18-12-13-21-19(23-18)22-16-10-6-1-2-7-11-16/h3-5,8-9,12-13,16-17H,1-2,6-7,10-11,14H2,(H,21,22,23)/t17-/m1/s1 |
| InChIKey | RRPDLVUUBWTLNP-QGZVFWFLSA-N |
| XLogP | 4.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |