C19H17NO2 — CID 102208888
(4R)-3-(3-methyl-1H-inden-2-yl)-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102208888) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is (4R)-3-(3-methyl-1H-inden-2-yl)-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-(3-methyl-1H-inden-2-yl)-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102208888 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (4R)-3-(3-methyl-1H-inden-2-yl)-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1=C(N2C(=O)OC[C@H]2c2ccccc2)Cc2ccccc21 |
| InChI | InChI=1S/C19H17NO2/c1-13-16-10-6-5-9-15(16)11-17(13)20-18(12-22-19(20)21)14-7-3-2-4-8-14/h2-10,18H,11-12H2,1H3/t18-/m0/s1 |
| InChIKey | HYARDZCMGWXMJK-SFHVURJKSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |