C21H19NO4 — CID 100995555
(4S)-3-[(1R,2R,6S,7S)-4-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 100995555) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is (4S)-3-[(1R,2R,6S,7S)-4-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1R,2R,6S,7S)-4-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 100995555 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (4S)-3-[(1R,2R,6S,7S)-4-methyl-5-oxotricyclo[5.2.1.02,6]deca-3,8-diene-3-carbonyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC1=C(C(=O)N2C(=O)OC[C@@H]2c2ccccc2)[C@H]2[C@@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C21H19NO4/c1-11-16(17-13-7-8-14(9-13)18(17)19(11)23)20(24)22-15(10-26-21(22)25)12-5-3-2-4-6-12/h2-8,13-15,17-18H,9-10H2,1H3/t13-,14+,15+,17-,18-/m0/s1 |
| InChIKey | COZWFBYGDCDLBT-INSJMTBZSA-N |
| XLogP | 3.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|