C16H21NO3 — CID 11161687
(4S)-3-[(3S)-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11161687) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (4S)-3-[(3S)-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3S)-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11161687 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (4S)-3-[(3S)-3-methylhexanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H](C)CC(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-3-7-12(2)10-15(18)17-14(11-20-16(17)19)13-8-5-4-6-9-13/h4-6,8-9,12,14H,3,7,10-11H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | NFJIPEWPXRHZIG-GXTWGEPZSA-N |
| XLogP | 3.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |