C29H29NO3 — CID 21196480
2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol (PubChem CID 21196480) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol.
| Compound Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 21196480 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[(4,5-diphenyl-1,3-oxazol-2-yl)methyl]-1-(3-methoxyphenyl)cyclohexan-1-ol |
| SMILES | COc1cccc(C2(O)CCCCC2Cc2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C29H29NO3/c1-32-25-17-10-16-23(19-25)29(31)18-9-8-15-24(29)20-26-30-27(21-11-4-2-5-12-21)28(33-26)22-13-6-3-7-14-22/h2-7,10-14,16-17,19,24,31H,8-9,15,18,20H2,1H3 |
| InChIKey | IVOGEADIBXWYJM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |