C27H24N2O3 — CID 57196602
benzyl (2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 57196602) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is benzyl (2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57196602 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | benzyl (2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@H]1c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C27H24N2O3/c30-27(31-19-20-11-4-1-5-12-20)29-18-10-17-23(29)26-28-24(21-13-6-2-7-14-21)25(32-26)22-15-8-3-9-16-22/h1-9,11-16,23H,10,17-19H2/t23-/m0/s1 |
| InChIKey | YJORRNKAOFFTGB-QHCPKHFHSA-N |
| XLogP | 6.48 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |