C28H25N2O4- — CID 91936165
2-[3-[[(2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]methyl]phenoxy]acetate (PubChem CID 91936165) has the molecular formula C28H25N2O4- and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[3-[[(2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]methyl]phenoxy]acetate.
| Compound Name | 2-[3-[[(2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 91936165 |
| Molecular Formula | C28H25N2O4- |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[3-[[(2S)-2-(4,5-diphenyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1cccc(CN2CCC[C@H]2c2nc(-c3ccccc3)c(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C28H26N2O4/c31-25(32)19-33-23-14-7-9-20(17-23)18-30-16-8-15-24(30)28-29-26(21-10-3-1-4-11-21)27(34-28)22-12-5-2-6-13-22/h1-7,9-14,17,24H,8,15-16,18-19H2,(H,31,32)/p-1/t24-/m0/s1 |
| InChIKey | WVTUDMXKOFCUFN-DEOSSOPVSA-M |
| XLogP | 4.47 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |