C32H32N2O4 — CID 18367393
2-[[5-[2-(4,5-diphenyl-1,3-oxazol-2-yl)piperidin-1-yl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 18367393) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-[[5-[2-(4,5-diphenyl-1,3-oxazol-2-yl)piperidin-1-yl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[2-(4,5-diphenyl-1,3-oxazol-2-yl)piperidin-1-yl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 18367393 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-[[5-[2-(4,5-diphenyl-1,3-oxazol-2-yl)piperidin-1-yl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCCC2N1CCCCC1c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C32H32N2O4/c35-29(36)21-37-28-19-10-15-24-25(28)16-9-18-26(24)34-20-8-7-17-27(34)32-33-30(22-11-3-1-4-12-22)31(38-32)23-13-5-2-6-14-23/h1-6,10-15,19,26-27H,7-9,16-18,20-21H2,(H,35,36) |
| InChIKey | ROUKFCTUKSQTIM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |