C24H22NO5S- — CID 67182587
5-(carboxymethoxy)-1-(4-phenyl-N-sulfinatoanilino)-1,2,3,4-tetrahydronaphthalene (PubChem CID 67182587) has the molecular formula C24H22NO5S- and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-(4-phenyl-N-sulfinatoanilino)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-(4-phenyl-N-sulfinatoanilino)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 67182587 |
| Molecular Formula | C24H22NO5S- |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 5-(carboxymethoxy)-1-(4-phenyl-N-sulfinatoanilino)-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1ccc(-c2ccccc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C24H23NO5S/c26-24(27)16-30-23-11-5-8-20-21(23)9-4-10-22(20)25(31(28)29)19-14-12-18(13-15-19)17-6-2-1-3-7-17/h1-3,5-8,11-15,22H,4,9-10,16H2,(H,26,27)(H,28,29)/p-1 |
| InChIKey | JFAVSFBZFCBJCW-UHFFFAOYSA-M |
| XLogP | 4.50 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|