C24H24N2O6S — CID 67182685
2-[[5-[[6-(3-methoxyphenyl)-3-pyridinyl]-sulfinoamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 67182685) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is 2-[[5-[[6-(3-methoxyphenyl)-3-pyridinyl]-sulfinoamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[[6-(3-methoxyphenyl)-3-pyridinyl]-sulfinoamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 67182685 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-[[5-[[6-(3-methoxyphenyl)-3-pyridinyl]-sulfinoamino]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | COc1cccc(-c2ccc(N(C3CCCc4c(OCC(=O)O)cccc43)S(=O)O)cn2)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-31-18-6-2-5-16(13-18)21-12-11-17(14-25-21)26(33(29)30)22-9-3-8-20-19(22)7-4-10-23(20)32-15-24(27)28/h2,4-7,10-14,22H,3,8-9,15H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | QZJXTWOXPMQWSX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|