C24H22NO6S- — CID 66633865
5-(carboxymethoxy)-1-[4-(4-hydroxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 66633865) has the molecular formula C24H22NO6S- and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[4-(4-hydroxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[4-(4-hydroxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 66633865 |
| Molecular Formula | C24H22NO6S- |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 5-(carboxymethoxy)-1-[4-(4-hydroxyphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1ccc(-c2ccc(O)cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C24H23NO6S/c26-19-13-9-17(10-14-19)16-7-11-18(12-8-16)25(32(29)30)22-5-1-4-21-20(22)3-2-6-23(21)31-15-24(27)28/h2-3,6-14,22,26H,1,4-5,15H2,(H,27,28)(H,29,30)/p-1 |
| InChIKey | RZCWZGYJPSBYFP-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|