C24H21FNO5S- — CID 66633483
5-(carboxymethoxy)-1-[4-(4-fluorophenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 66633483) has the molecular formula C24H21FNO5S- and a molecular weight of 454.50 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[4-(4-fluorophenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[4-(4-fluorophenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 66633483 |
| Molecular Formula | C24H21FNO5S- |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 5-(carboxymethoxy)-1-[4-(4-fluorophenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C(O)COc1cccc2c1CCCC2N(c1ccc(-c2ccc(F)cc2)cc1)S(=O)[O-] |
| InChI | InChI=1S/C24H22FNO5S/c25-18-11-7-16(8-12-18)17-9-13-19(14-10-17)26(32(29)30)22-5-1-4-21-20(22)3-2-6-23(21)31-15-24(27)28/h2-3,6-14,22H,1,4-5,15H2,(H,27,28)(H,29,30)/p-1 |
| InChIKey | YYTULZGNHXKGBE-UHFFFAOYSA-M |
| XLogP | 4.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|