C24H24FNO4 — CID 147329931
2-[4-[[3-(4-ethoxy-2-methylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid (PubChem CID 147329931) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[4-[[3-(4-ethoxy-2-methylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid.
| Compound Name | 2-[4-[[3-(4-ethoxy-2-methylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 147329931 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 2-[4-[[3-(4-ethoxy-2-methylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid |
| SMILES | CCOc1ccc(-c2cccc(CNc3ccc(OCC(=O)O)c(F)c3)c2)c(C)c1 |
| InChI | InChI=1S/C24H24FNO4/c1-3-29-20-8-9-21(16(2)11-20)18-6-4-5-17(12-18)14-26-19-7-10-23(22(25)13-19)30-15-24(27)28/h4-13,26H,3,14-15H2,1-2H3,(H,27,28) |
| InChIKey | DBLRLBZWFQIKEN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|