C25H26FNO4 — CID 149144496
2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid (PubChem CID 149144496) has the molecular formula C25H26FNO4 and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid.
| Compound Name | 2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 149144496 |
| Molecular Formula | C25H26FNO4 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[4-[[3-(4-ethoxy-2,6-dimethylphenyl)phenyl]methylamino]-2-fluorophenoxy]acetic acid |
| SMILES | CCOc1cc(C)c(-c2cccc(CNc3ccc(OCC(=O)O)c(F)c3)c2)c(C)c1 |
| InChI | InChI=1S/C25H26FNO4/c1-4-30-21-10-16(2)25(17(3)11-21)19-7-5-6-18(12-19)14-27-20-8-9-23(22(26)13-20)31-15-24(28)29/h5-13,27H,4,14-15H2,1-3H3,(H,28,29) |
| InChIKey | RJOSBMNJSVPJMQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|