C27H27N2O6S- — CID 77258456
5-(carboxymethoxy)-1-[4-[3-(dimethylcarbamoyl)phenyl]-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 77258456) has the molecular formula C27H27N2O6S- and a molecular weight of 507.59 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[4-[3-(dimethylcarbamoyl)phenyl]-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[4-[3-(dimethylcarbamoyl)phenyl]-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 77258456 |
| Molecular Formula | C27H27N2O6S- |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 5-(carboxymethoxy)-1-[4-[3-(dimethylcarbamoyl)phenyl]-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CN(C)C(=O)c1cccc(-c2ccc(N(C3CCCc4c(OCC(=O)O)cccc43)S(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C27H28N2O6S/c1-28(2)27(32)20-7-3-6-19(16-20)18-12-14-21(15-13-18)29(36(33)34)24-10-4-9-23-22(24)8-5-11-25(23)35-17-26(30)31/h3,5-8,11-16,24H,4,9-10,17H2,1-2H3,(H,30,31)(H,33,34)/p-1 |
| InChIKey | VOIVHIHBFYDIRU-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|