C25H24NO5S2- — CID 67184355
5-(carboxymethoxy)-1-[4-(3-methylsulfanylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene (PubChem CID 67184355) has the molecular formula C25H24NO5S2- and a molecular weight of 482.60 g/mol. Its IUPAC name is 5-(carboxymethoxy)-1-[4-(3-methylsulfanylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(carboxymethoxy)-1-[4-(3-methylsulfanylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 67184355 |
| Molecular Formula | C25H24NO5S2- |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 5-(carboxymethoxy)-1-[4-(3-methylsulfanylphenyl)-N-sulfinatoanilino]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CSc1cccc(-c2ccc(N(C3CCCc4c(OCC(=O)O)cccc43)S(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H25NO5S2/c1-32-20-6-2-5-18(15-20)17-11-13-19(14-12-17)26(33(29)30)23-9-3-8-22-21(23)7-4-10-24(22)31-16-25(27)28/h2,4-7,10-15,23H,3,8-9,16H2,1H3,(H,27,28)(H,29,30)/p-1 |
| InChIKey | FELFCDUTUKBTQX-UHFFFAOYSA-M |
| XLogP | 5.22 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|