C35H32N2O4 — CID 15236832
2-[[5-[2-(2-oxo-3,4,5-triphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid (PubChem CID 15236832) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol. Its IUPAC name is 2-[[5-[2-(2-oxo-3,4,5-triphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid.
| Compound Name | 2-[[5-[2-(2-oxo-3,4,5-triphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 15236832 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-[[5-[2-(2-oxo-3,4,5-triphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1CCCC2CCn1c(-c2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C35H32N2O4/c38-32(39)24-41-31-21-11-19-29-25(16-10-20-30(29)31)22-23-36-33(26-12-4-1-5-13-26)34(27-14-6-2-7-15-27)37(35(36)40)28-17-8-3-9-18-28/h1-9,11-15,17-19,21,25H,10,16,20,22-24H2,(H,38,39) |
| InChIKey | KTECRIMONSEGDS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |