C25H19NO4 — CID 10069380
2-[2-[(E)-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetic acid (PubChem CID 10069380) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[2-[(E)-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10069380 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[2-[(E)-2-(4,5-diphenyl-1,3-oxazol-2-yl)ethenyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1/C=C/c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C25H19NO4/c27-23(28)17-29-21-14-8-7-9-18(21)15-16-22-26-24(19-10-3-1-4-11-19)25(30-22)20-12-5-2-6-13-20/h1-16H,17H2,(H,27,28)/b16-15+ |
| InChIKey | WRSULSWWOKGAJH-FOCLMDBBSA-N |
| XLogP | 5.64 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |