C21H15NOS — CID 126495209
4,5-diphenyl-2-[(E)-2-thiophen-2-ylethenyl]-1,3-oxazole (PubChem CID 126495209) has the molecular formula C21H15NOS and a molecular weight of 329.42 g/mol. Its IUPAC name is 4,5-diphenyl-2-[(E)-2-thiophen-2-ylethenyl]-1,3-oxazole.
| Compound Name | 4,5-diphenyl-2-[(E)-2-thiophen-2-ylethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 126495209 |
| Molecular Formula | C21H15NOS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4,5-diphenyl-2-[(E)-2-thiophen-2-ylethenyl]-1,3-oxazole |
| SMILES | C(=C/c1cccs1)\c1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C21H15NOS/c1-3-8-16(9-4-1)20-21(17-10-5-2-6-11-17)23-19(22-20)14-13-18-12-7-15-24-18/h1-15H/b14-13+ |
| InChIKey | WMKHEJAMKQPIJQ-BUHFOSPRSA-N |
| XLogP | 6.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |