C24H28N2O3 — CID 68573073
benzyl (2S)-2-(6-pentyl-1,3-benzoxazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 68573073) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is benzyl (2S)-2-(6-pentyl-1,3-benzoxazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(6-pentyl-1,3-benzoxazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68573073 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | benzyl (2S)-2-(6-pentyl-1,3-benzoxazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CCCCCc1ccc2nc([C@@H]3CCCN3C(=O)OCc3ccccc3)oc2c1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-3-5-9-18-13-14-20-22(16-18)29-23(25-20)21-12-8-15-26(21)24(27)28-17-19-10-6-4-7-11-19/h4,6-7,10-11,13-14,16,21H,2-3,5,8-9,12,15,17H2,1H3/t21-/m0/s1 |
| InChIKey | CRUDUNNGHHWSQQ-NRFANRHFSA-N |
| XLogP | 6.03 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|