C30H32N2O2 — CID 93015379
[(2R)-2-[5-(3-methylphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone (PubChem CID 93015379) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is [(2R)-2-[5-(3-methylphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone.
| Compound Name | [(2R)-2-[5-(3-methylphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone |
|---|---|
| PubChem CID | 93015379 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | [(2R)-2-[5-(3-methylphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-pentylphenyl)methanone |
| SMILES | CCCCCc1ccc(C(=O)N2CCC[C@@H]2c2nc3cc(-c4cccc(C)c4)ccc3o2)cc1 |
| InChI | InChI=1S/C30H32N2O2/c1-3-4-5-9-22-12-14-23(15-13-22)30(33)32-18-7-11-27(32)29-31-26-20-25(16-17-28(26)34-29)24-10-6-8-21(2)19-24/h6,8,10,12-17,19-20,27H,3-5,7,9,11,18H2,1-2H3/t27-/m1/s1 |
| InChIKey | PXHQBTWENLELJF-HHHXNRCGSA-N |
| XLogP | 7.51 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|