C25H21N3O5 — CID 46107292
[2-[5-(3-methoxyphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 46107292) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is [2-[5-(3-methoxyphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [2-[5-(3-methoxyphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46107292 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [2-[5-(3-methoxyphenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1cccc(-c2ccc3oc(C4CCCN4C(=O)c4ccc([N+](=O)[O-])cc4)nc3c2)c1 |
| InChI | InChI=1S/C25H21N3O5/c1-32-20-5-2-4-17(14-20)18-9-12-23-21(15-18)26-24(33-23)22-6-3-13-27(22)25(29)16-7-10-19(11-8-16)28(30)31/h2,4-5,7-12,14-15,22H,3,6,13H2,1H3 |
| InChIKey | YEHNYXWGBYXYMR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|