C25H18F3N3O4 — CID 93015649
(3-nitrophenyl)-[(2R)-2-[5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]methanone (PubChem CID 93015649) has the molecular formula C25H18F3N3O4 and a molecular weight of 481.43 g/mol. Its IUPAC name is (3-nitrophenyl)-[(2R)-2-[5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (3-nitrophenyl)-[(2R)-2-[5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 93015649 |
| Molecular Formula | C25H18F3N3O4 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (3-nitrophenyl)-[(2R)-2-[5-[4-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCC[C@@H]1c1nc2cc(-c3ccc(C(F)(F)F)cc3)ccc2o1 |
| InChI | InChI=1S/C25H18F3N3O4/c26-25(27,28)18-9-6-15(7-10-18)16-8-11-22-20(14-16)29-23(35-22)21-5-2-12-30(21)24(32)17-3-1-4-19(13-17)31(33)34/h1,3-4,6-11,13-14,21H,2,5,12H2/t21-/m1/s1 |
| InChIKey | CVRJMLOVNSCQJK-OAQYLSRUSA-N |
| XLogP | 6.40 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|