C24H17F2N3O4 — CID 93015551
[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(3-nitrophenyl)methanone (PubChem CID 93015551) has the molecular formula C24H17F2N3O4 and a molecular weight of 449.41 g/mol. Its IUPAC name is [(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 93015551 |
| Molecular Formula | C24H17F2N3O4 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]-(3-nitrophenyl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCC[C@@H]1c1nc2cc(-c3ccc(F)cc3F)ccc2o1 |
| InChI | InChI=1S/C24H17F2N3O4/c25-16-7-8-18(19(26)13-16)14-6-9-22-20(12-14)27-23(33-22)21-5-2-10-28(21)24(30)15-3-1-4-17(11-15)29(31)32/h1,3-4,6-9,11-13,21H,2,5,10H2/t21-/m1/s1 |
| InChIKey | UCOQZPMYUHSKMD-OAQYLSRUSA-N |
| XLogP | 5.66 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|