C20H17ClF2N2O2 — CID 93015604
3-chloro-1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]propan-1-one (PubChem CID 93015604) has the molecular formula C20H17ClF2N2O2 and a molecular weight of 390.82 g/mol. Its IUPAC name is 3-chloro-1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 93015604 |
| Molecular Formula | C20H17ClF2N2O2 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-chloro-1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCCl)N1CCC[C@@H]1c1nc2cc(-c3ccc(F)cc3F)ccc2o1 |
| InChI | InChI=1S/C20H17ClF2N2O2/c21-8-7-19(26)25-9-1-2-17(25)20-24-16-10-12(3-6-18(16)27-20)14-5-4-13(22)11-15(14)23/h3-6,10-11,17H,1-2,7-9H2/t17-/m1/s1 |
| InChIKey | GJYMWFDVLBFXTL-QGZVFWFLSA-N |
| XLogP | 5.07 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|