C24H26F2N2O2 — CID 93015587
1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]heptan-1-one (PubChem CID 93015587) has the molecular formula C24H26F2N2O2 and a molecular weight of 412.48 g/mol. Its IUPAC name is 1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]heptan-1-one.
| Compound Name | 1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 93015587 |
| Molecular Formula | C24H26F2N2O2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-[(2R)-2-[5-(2,4-difluorophenyl)-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCC[C@@H]1c1nc2cc(-c3ccc(F)cc3F)ccc2o1 |
| InChI | InChI=1S/C24H26F2N2O2/c1-2-3-4-5-8-23(29)28-13-6-7-21(28)24-27-20-14-16(9-12-22(20)30-24)18-11-10-17(25)15-19(18)26/h9-12,14-15,21H,2-8,13H2,1H3/t21-/m1/s1 |
| InChIKey | CJHMDKSWLCZUBY-OAQYLSRUSA-N |
| XLogP | 6.41 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|