C20H17ClN4O5 — CID 42765348
(2-chloro-4-nitrophenyl)-[2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone (PubChem CID 42765348) has the molecular formula C20H17ClN4O5 and a molecular weight of 428.83 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl)-[2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-4-nitrophenyl)-[2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42765348 |
| Molecular Formula | C20H17ClN4O5 |
| Molecular Weight | 428.83 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (2-chloro-4-nitrophenyl)-[2-[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]methanone |
| SMILES | COc1cccc(-c2noc(C3CCCN3C(=O)c3ccc([N+](=O)[O-])cc3Cl)n2)c1 |
| InChI | InChI=1S/C20H17ClN4O5/c1-29-14-5-2-4-12(10-14)18-22-19(30-23-18)17-6-3-9-24(17)20(26)15-8-7-13(25(27)28)11-16(15)21/h2,4-5,7-8,10-11,17H,3,6,9H2,1H3 |
| InChIKey | ONPPYPRQNYZOMA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|