C19H16N4O4 — CID 7415815
(3-nitrophenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone (PubChem CID 7415815) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is (3-nitrophenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-nitrophenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 7415815 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (3-nitrophenyl)-[(2R)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCC[C@@H]1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H16N4O4/c24-19(14-8-4-9-15(12-14)23(25)26)22-11-5-10-16(22)18-20-17(21-27-18)13-6-2-1-3-7-13/h1-4,6-9,12,16H,5,10-11H2/t16-/m1/s1 |
| InChIKey | ISVLWWHWMPJDNR-MRXNPFEDSA-N |
| XLogP | 3.62 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|