C19H15ClN4O4 — CID 7295782
(4-chloro-3-nitrophenyl)-[(2S)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone (PubChem CID 7295782) has the molecular formula C19H15ClN4O4 and a molecular weight of 398.81 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[(2S)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[(2S)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 7295782 |
| Molecular Formula | C19H15ClN4O4 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[(2S)-2-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1CCC[C@H]1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H15ClN4O4/c20-14-9-8-13(11-16(14)24(26)27)19(25)23-10-4-7-15(23)18-21-17(22-28-18)12-5-2-1-3-6-12/h1-3,5-6,8-9,11,15H,4,7,10H2/t15-/m0/s1 |
| InChIKey | VNMAGFYHHREASC-HNNXBMFYSA-N |
| XLogP | 4.28 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|