C13H16O2S — CID 105498140
3-(thian-3-ylmethyl)benzoic acid (PubChem CID 105498140) has the molecular formula C13H16O2S and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-(thian-3-ylmethyl)benzoic acid.
| Compound Name | 3-(thian-3-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 105498140 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3-(thian-3-ylmethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(CC2CCCSC2)c1 |
| InChI | InChI=1S/C13H16O2S/c14-13(15)12-5-1-3-10(8-12)7-11-4-2-6-16-9-11/h1,3,5,8,11H,2,4,6-7,9H2,(H,14,15) |
| InChIKey | UDFQHGUEARJBMW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |