C18H25N3O3 — CID 95729628
3-[[(3S)-1-(4-methylpiperazine-1-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid (PubChem CID 95729628) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-[[(3S)-1-(4-methylpiperazine-1-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3S)-1-(4-methylpiperazine-1-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 95729628 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-[[(3S)-1-(4-methylpiperazine-1-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid |
| SMILES | CN1CCN(C(=O)N2CC[C@H](Cc3cccc(C(=O)O)c3)C2)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-19-7-9-20(10-8-19)18(24)21-6-5-15(13-21)11-14-3-2-4-16(12-14)17(22)23/h2-4,12,15H,5-11,13H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | CBUUBZCAVVKSNL-OAHLLOKOSA-N |
| XLogP | 1.62 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |