C20H19N3O3 — CID 56886998
3-[[1-(3H-benzimidazole-5-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid (PubChem CID 56886998) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-[[1-(3H-benzimidazole-5-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[1-(3H-benzimidazole-5-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 56886998 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-[[1-(3H-benzimidazole-5-carbonyl)pyrrolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CC2CCN(C(=O)c3ccc4nc[nH]c4c3)C2)c1 |
| InChI | InChI=1S/C20H19N3O3/c24-19(15-4-5-17-18(10-15)22-12-21-17)23-7-6-14(11-23)8-13-2-1-3-16(9-13)20(25)26/h1-5,9-10,12,14H,6-8,11H2,(H,21,22)(H,25,26) |
| InChIKey | UTICJKLOKTZJGU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |