C17H19N5O — CID 110106421
3H-benzimidazol-5-yl-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]methanone (PubChem CID 110106421) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110106421 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3H-benzimidazol-5-yl-[3-(1H-pyrazol-5-ylmethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCCC(Cc2ccn[nH]2)C1 |
| InChI | InChI=1S/C17H19N5O/c23-17(13-3-4-15-16(9-13)19-11-18-15)22-7-1-2-12(10-22)8-14-5-6-20-21-14/h3-6,9,11-12H,1-2,7-8,10H2,(H,18,19)(H,20,21) |
| InChIKey | UGGUISXJGSNRRG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |