C17H24N2O4S — CID 97131866
3-[[(3S)-1-piperidin-1-ylsulfonylpyrrolidin-3-yl]methyl]benzoic acid (PubChem CID 97131866) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[[(3S)-1-piperidin-1-ylsulfonylpyrrolidin-3-yl]methyl]benzoic acid.
| Compound Name | 3-[[(3S)-1-piperidin-1-ylsulfonylpyrrolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 97131866 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 3-[[(3S)-1-piperidin-1-ylsulfonylpyrrolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C[C@H]2CCN(S(=O)(=O)N3CCCCC3)C2)c1 |
| InChI | InChI=1S/C17H24N2O4S/c20-17(21)16-6-4-5-14(12-16)11-15-7-10-19(13-15)24(22,23)18-8-2-1-3-9-18/h4-6,12,15H,1-3,7-11,13H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | IVULVLKVHBCGSR-OAHLLOKOSA-N |
| XLogP | 1.98 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |