C17H24N2OS2 — CID 72851048
3-[[1-(1,4-dithiepan-6-yl)pyrrolidin-3-yl]methyl]benzamide (PubChem CID 72851048) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 3-[[1-(1,4-dithiepan-6-yl)pyrrolidin-3-yl]methyl]benzamide.
| Compound Name | 3-[[1-(1,4-dithiepan-6-yl)pyrrolidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 72851048 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-[[1-(1,4-dithiepan-6-yl)pyrrolidin-3-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CC2CCN(C3CSCCSC3)C2)c1 |
| InChI | InChI=1S/C17H24N2OS2/c18-17(20)15-3-1-2-13(9-15)8-14-4-5-19(10-14)16-11-21-6-7-22-12-16/h1-3,9,14,16H,4-8,10-12H2,(H2,18,20) |
| InChIKey | JTHAMQFFKIAJCI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |