C14H19NO3S — CID 124681406
3-[2-[[(3R)-thian-3-yl]amino]ethoxy]benzoic acid (PubChem CID 124681406) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[2-[[(3R)-thian-3-yl]amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[[(3R)-thian-3-yl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 124681406 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-[2-[[(3R)-thian-3-yl]amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCN[C@@H]2CCCSC2)c1 |
| InChI | InChI=1S/C14H19NO3S/c16-14(17)11-3-1-5-13(9-11)18-7-6-15-12-4-2-8-19-10-12/h1,3,5,9,12,15H,2,4,6-8,10H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | YMFREBIXATUFGI-GFCCVEGCSA-N |
| XLogP | 2.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|