C14H18N2O4 — CID 103248577
3-[2-[(2-oxopiperidin-3-yl)amino]ethoxy]benzoic acid (PubChem CID 103248577) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[2-[(2-oxopiperidin-3-yl)amino]ethoxy]benzoic acid.
| Compound Name | 3-[2-[(2-oxopiperidin-3-yl)amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 103248577 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-[2-[(2-oxopiperidin-3-yl)amino]ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCNC2CCCNC2=O)c1 |
| InChI | InChI=1S/C14H18N2O4/c17-13-12(5-2-6-16-13)15-7-8-20-11-4-1-3-10(9-11)14(18)19/h1,3-4,9,12,15H,2,5-8H2,(H,16,17)(H,18,19) |
| InChIKey | PYIJNPMLDFPNBP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|