C14H19NO3S2 — CID 103264357
3-[2-(1,4-dithian-2-ylmethylamino)ethoxy]benzoic acid (PubChem CID 103264357) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-[2-(1,4-dithian-2-ylmethylamino)ethoxy]benzoic acid.
| Compound Name | 3-[2-(1,4-dithian-2-ylmethylamino)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 103264357 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-[2-(1,4-dithian-2-ylmethylamino)ethoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCCNCC2CSCCS2)c1 |
| InChI | InChI=1S/C14H19NO3S2/c16-14(17)11-2-1-3-12(8-11)18-5-4-15-9-13-10-19-6-7-20-13/h1-3,8,13,15H,4-7,9-10H2,(H,16,17) |
| InChIKey | SCLQKJXEKAJKIC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|