C13H15F2NO2S2 — CID 124609151
3-(difluoromethoxy)-N-[[(2S)-1,4-dithian-2-yl]methyl]benzamide (PubChem CID 124609151) has the molecular formula C13H15F2NO2S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[[(2S)-1,4-dithian-2-yl]methyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[[(2S)-1,4-dithian-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 124609151 |
| Molecular Formula | C13H15F2NO2S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-(difluoromethoxy)-N-[[(2S)-1,4-dithian-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1CSCCS1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C13H15F2NO2S2/c14-13(15)18-10-3-1-2-9(6-10)12(17)16-7-11-8-19-4-5-20-11/h1-3,6,11,13H,4-5,7-8H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | FAKBPFKFIQWHME-NSHDSACASA-N |
| XLogP | 2.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |