C14H16BrF2NO2 — CID 114313814
N-[(2-bromocyclopentyl)methyl]-3-(difluoromethoxy)benzamide (PubChem CID 114313814) has the molecular formula C14H16BrF2NO2 and a molecular weight of 348.19 g/mol. Its IUPAC name is N-[(2-bromocyclopentyl)methyl]-3-(difluoromethoxy)benzamide.
| Compound Name | N-[(2-bromocyclopentyl)methyl]-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 114313814 |
| Molecular Formula | C14H16BrF2NO2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-[(2-bromocyclopentyl)methyl]-3-(difluoromethoxy)benzamide |
| SMILES | O=C(NCC1CCCC1Br)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H16BrF2NO2/c15-12-6-2-4-10(12)8-18-13(19)9-3-1-5-11(7-9)20-14(16)17/h1,3,5,7,10,12,14H,2,4,6,8H2,(H,18,19) |
| InChIKey | GIOCIONSGIENLN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|