C33H29NO6 — CID 10347082
2-[5-[6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid (PubChem CID 10347082) has the molecular formula C33H29NO6 and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-[5-[6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid.
| Compound Name | 2-[5-[6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid |
|---|---|
| PubChem CID | 10347082 |
| Molecular Formula | C33H29NO6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 2-[5-[6-(4,5-diphenyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxypentyl]propanedioic acid |
| SMILES | O=C(O)C(CCCCCOc1ccc2cc(-c3nc(-c4ccccc4)c(-c4ccccc4)o3)ccc2c1)C(=O)O |
| InChI | InChI=1S/C33H29NO6/c35-32(36)28(33(37)38)14-8-3-9-19-39-27-18-17-24-20-26(16-15-25(24)21-27)31-34-29(22-10-4-1-5-11-22)30(40-31)23-12-6-2-7-13-23/h1-2,4-7,10-13,15-18,20-21,28H,3,8-9,14,19H2,(H,35,36)(H,37,38) |
| InChIKey | QCHHBZOJEMSBBD-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|