C41H51NO11 — CID 10439953
diethyl 2-[5-[6-[6-(7-ethoxy-6-ethoxycarbonyl-7-oxoheptoxy)-1,3-benzoxazol-2-yl]naphthalen-2-yl]oxypentyl]propanedioate (PubChem CID 10439953) has the molecular formula C41H51NO11 and a molecular weight of 733.86 g/mol. Its IUPAC name is diethyl 2-[5-[6-[6-(7-ethoxy-6-ethoxycarbonyl-7-oxoheptoxy)-1,3-benzoxazol-2-yl]naphthalen-2-yl]oxypentyl]propanedioate.
| Compound Name | diethyl 2-[5-[6-[6-(7-ethoxy-6-ethoxycarbonyl-7-oxoheptoxy)-1,3-benzoxazol-2-yl]naphthalen-2-yl]oxypentyl]propanedioate |
|---|---|
| PubChem CID | 10439953 |
| Molecular Formula | C41H51NO11 |
| Molecular Weight | 733.86 g/mol |
| Exact Mass | 733.35 |
| IUPAC Name | diethyl 2-[5-[6-[6-(7-ethoxy-6-ethoxycarbonyl-7-oxoheptoxy)-1,3-benzoxazol-2-yl]naphthalen-2-yl]oxypentyl]propanedioate |
| SMILES | CCOC(=O)C(CCCCCOc1ccc2cc(-c3nc4ccc(OCCCCCC(C(=O)OCC)C(=O)OCC)cc4o3)ccc2c1)C(=O)OCC |
| InChI | InChI=1S/C41H51NO11/c1-5-47-38(43)33(39(44)48-6-2)15-11-9-13-23-51-31-20-19-28-25-30(18-17-29(28)26-31)37-42-35-22-21-32(27-36(35)53-37)52-24-14-10-12-16-34(40(45)49-7-3)41(46)50-8-4/h17-22,25-27,33-34H,5-16,23-24H2,1-4H3 |
| InChIKey | GNBFZVKKEJDXTJ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 149.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.86 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|