C26H27NO5 — CID 11743593
ethyl 6-[6-(6-methoxy-1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate (PubChem CID 11743593) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is ethyl 6-[6-(6-methoxy-1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate.
| Compound Name | ethyl 6-[6-(6-methoxy-1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 11743593 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | ethyl 6-[6-(6-methoxy-1,3-benzoxazol-2-yl)naphthalen-2-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc2cc(-c3nc4ccc(OC)cc4o3)ccc2c1 |
| InChI | InChI=1S/C26H27NO5/c1-3-30-25(28)7-5-4-6-14-31-22-11-10-18-15-20(9-8-19(18)16-22)26-27-23-13-12-21(29-2)17-24(23)32-26/h8-13,15-17H,3-7,14H2,1-2H3 |
| InChIKey | BJSSUZYYRXPMNI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|