C25H31NO4 — CID 10364169
ethyl 6-[6-(4-tert-butyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxyhexanoate (PubChem CID 10364169) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 6-[6-(4-tert-butyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxyhexanoate.
| Compound Name | ethyl 6-[6-(4-tert-butyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10364169 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | ethyl 6-[6-(4-tert-butyl-1,3-oxazol-2-yl)naphthalen-2-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc2cc(-c3nc(C(C)(C)C)co3)ccc2c1 |
| InChI | InChI=1S/C25H31NO4/c1-5-28-23(27)9-7-6-8-14-29-21-13-12-18-15-20(11-10-19(18)16-21)24-26-22(17-30-24)25(2,3)4/h10-13,15-17H,5-9,14H2,1-4H3 |
| InChIKey | VDOWMAQEIVOMEC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|