C23H31NO3 — CID 67743403
ethyl 6-[(6-tert-butyl-4-phenyl-2-pyridinyl)oxy]hexanoate (PubChem CID 67743403) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 6-[(6-tert-butyl-4-phenyl-2-pyridinyl)oxy]hexanoate.
| Compound Name | ethyl 6-[(6-tert-butyl-4-phenyl-2-pyridinyl)oxy]hexanoate |
|---|---|
| PubChem CID | 67743403 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | ethyl 6-[(6-tert-butyl-4-phenyl-2-pyridinyl)oxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc(-c2ccccc2)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C23H31NO3/c1-5-26-22(25)14-10-7-11-15-27-21-17-19(18-12-8-6-9-13-18)16-20(24-21)23(2,3)4/h6,8-9,12-13,16-17H,5,7,10-11,14-15H2,1-4H3 |
| InChIKey | SOVMLHFCNLSULT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|