C26H24N2O4 — CID 135932191
ethyl 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate (PubChem CID 135932191) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate.
| Compound Name | ethyl 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate |
|---|---|
| PubChem CID | 135932191 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | ethyl 4-[2-(6-hydroxynaphthalen-2-yl)-6-phenylpyrimidin-4-yl]oxybutanoate |
| SMILES | CCOC(=O)CCCOc1cc(-c2ccccc2)nc(-c2ccc3cc(O)ccc3c2)n1 |
| InChI | InChI=1S/C26H24N2O4/c1-2-31-25(30)9-6-14-32-24-17-23(18-7-4-3-5-8-18)27-26(28-24)21-11-10-20-16-22(29)13-12-19(20)15-21/h3-5,7-8,10-13,15-17,29H,2,6,9,14H2,1H3 |
| InChIKey | WAVVFANPSKPDBK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|