C23H24ClNO3 — CID 10453447
ethyl 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoate (PubChem CID 10453447) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is ethyl 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoate.
| Compound Name | ethyl 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10453447 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | ethyl 6-[4-(4-chlorophenyl)quinolin-2-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc(-c2ccc(Cl)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H24ClNO3/c1-2-27-23(26)10-4-3-7-15-28-22-16-20(17-11-13-18(24)14-12-17)19-8-5-6-9-21(19)25-22/h5-6,8-9,11-14,16H,2-4,7,10,15H2,1H3 |
| InChIKey | LSVYRYWYXMXRAG-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|