C26H23ClN2O4 — CID 91990722
ethyl 2-[2-[6-(2-chloroethoxy)naphthalen-2-yl]-6-phenylpyrimidin-4-yl]oxyacetate (PubChem CID 91990722) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is ethyl 2-[2-[6-(2-chloroethoxy)naphthalen-2-yl]-6-phenylpyrimidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[2-[6-(2-chloroethoxy)naphthalen-2-yl]-6-phenylpyrimidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 91990722 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | ethyl 2-[2-[6-(2-chloroethoxy)naphthalen-2-yl]-6-phenylpyrimidin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COc1cc(-c2ccccc2)nc(-c2ccc3cc(OCCCl)ccc3c2)n1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-2-31-25(30)17-33-24-16-23(18-6-4-3-5-7-18)28-26(29-24)21-9-8-20-15-22(32-13-12-27)11-10-19(20)14-21/h3-11,14-16H,2,12-13,17H2,1H3 |
| InChIKey | FQJCGHYMAIXTCV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|